C18H21N5O5S — CID 42928175
1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-3-[(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)amino]urea (PubChem CID 42928175) has the molecular formula C18H21N5O5S and a molecular weight of 419.46 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-3-[(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)amino]urea.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-3-[(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)amino]urea |
|---|---|
| PubChem CID | 42928175 |
| Molecular Formula | C18H21N5O5S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-3-[(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)amino]urea |
| SMILES | O=C(NCC1COc2ccccc2O1)NNC(=O)c1csc(N2CCOCC2)n1 |
| InChI | InChI=1S/C18H21N5O5S/c24-16(13-11-29-18(20-13)23-5-7-26-8-6-23)21-22-17(25)19-9-12-10-27-14-3-1-2-4-15(14)28-12/h1-4,11-12H,5-10H2,(H,21,24)(H2,19,22,25) |
| InChIKey | BEUDEYPEZNOACR-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 114.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|