C19H24N4O4S — CID 9161034
tert-butyl N-[3-[2-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)hydrazinyl]-3-oxopropyl]carbamate (PubChem CID 9161034) has the molecular formula C19H24N4O4S and a molecular weight of 404.49 g/mol. Its IUPAC name is tert-butyl N-[3-[2-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)hydrazinyl]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)hydrazinyl]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 9161034 |
| Molecular Formula | C19H24N4O4S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | tert-butyl N-[3-[2-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)hydrazinyl]-3-oxopropyl]carbamate |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)NNC(=O)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H24N4O4S/c1-12-15(28-17(21-12)13-8-6-5-7-9-13)16(25)23-22-14(24)10-11-20-18(26)27-19(2,3)4/h5-9H,10-11H2,1-4H3,(H,20,26)(H,22,24)(H,23,25) |
| InChIKey | AKFMCCDQOHSOKW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|