C22H22N4O3S — CID 25439163
3-methyl-N-[3-[2-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)hydrazinyl]-3-oxopropyl]benzamide (PubChem CID 25439163) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is 3-methyl-N-[3-[2-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)hydrazinyl]-3-oxopropyl]benzamide.
| Compound Name | 3-methyl-N-[3-[2-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)hydrazinyl]-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 25439163 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 3-methyl-N-[3-[2-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)hydrazinyl]-3-oxopropyl]benzamide |
| SMILES | Cc1cccc(C(=O)NCCC(=O)NNC(=O)c2sc(-c3ccccc3)nc2C)c1 |
| InChI | InChI=1S/C22H22N4O3S/c1-14-7-6-10-17(13-14)20(28)23-12-11-18(27)25-26-21(29)19-15(2)24-22(30-19)16-8-4-3-5-9-16/h3-10,13H,11-12H2,1-2H3,(H,23,28)(H,25,27)(H,26,29) |
| InChIKey | QLNMNYFLABFFMW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|