C17H17N5O4S — CID 51546504
N'-[3-[(4R)-2,5-dioxoimidazolidin-4-yl]propanoyl]-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide (PubChem CID 51546504) has the molecular formula C17H17N5O4S and a molecular weight of 387.42 g/mol. Its IUPAC name is N'-[3-[(4R)-2,5-dioxoimidazolidin-4-yl]propanoyl]-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-[3-[(4R)-2,5-dioxoimidazolidin-4-yl]propanoyl]-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 51546504 |
| Molecular Formula | C17H17N5O4S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | N'-[3-[(4R)-2,5-dioxoimidazolidin-4-yl]propanoyl]-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)NNC(=O)CC[C@H]1NC(=O)NC1=O |
| InChI | InChI=1S/C17H17N5O4S/c1-9-13(27-16(18-9)10-5-3-2-4-6-10)15(25)22-21-12(23)8-7-11-14(24)20-17(26)19-11/h2-6,11H,7-8H2,1H3,(H,21,23)(H,22,25)(H2,19,20,24,26)/t11-/m1/s1 |
| InChIKey | JOUUKYKHCABNCE-LLVKDONJSA-N |
| XLogP | 0.87 |
| TPSA | 129.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|