C17H18F2N2O2S — CID 94636445
(Z)-3-[2-(difluoromethoxy)phenyl]-N-[(1R)-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]prop-2-enamide (PubChem CID 94636445) has the molecular formula C17H18F2N2O2S and a molecular weight of 352.41 g/mol. Its IUPAC name is (Z)-3-[2-(difluoromethoxy)phenyl]-N-[(1R)-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]prop-2-enamide.
| Compound Name | (Z)-3-[2-(difluoromethoxy)phenyl]-N-[(1R)-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 94636445 |
| Molecular Formula | C17H18F2N2O2S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | (Z)-3-[2-(difluoromethoxy)phenyl]-N-[(1R)-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]prop-2-enamide |
| SMILES | Cc1nc(C)c([C@@H](C)NC(=O)/C=C\c2ccccc2OC(F)F)s1 |
| InChI | InChI=1S/C17H18F2N2O2S/c1-10-16(24-12(3)20-10)11(2)21-15(22)9-8-13-6-4-5-7-14(13)23-17(18)19/h4-9,11,17H,1-3H3,(H,21,22)/b9-8-/t11-/m1/s1 |
| InChIKey | JZGJCQPBKLCEBJ-TYBABMIJSA-N |
| XLogP | 4.25 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|