C21H21F2NO4 — CID 60590322
ethyl 3-[[(E)-3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]amino]-3-phenylpropanoate (PubChem CID 60590322) has the molecular formula C21H21F2NO4 and a molecular weight of 389.40 g/mol. Its IUPAC name is ethyl 3-[[(E)-3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]amino]-3-phenylpropanoate.
| Compound Name | ethyl 3-[[(E)-3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 60590322 |
| Molecular Formula | C21H21F2NO4 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | ethyl 3-[[(E)-3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]amino]-3-phenylpropanoate |
| SMILES | CCOC(=O)CC(NC(=O)/C=C/c1ccccc1OC(F)F)c1ccccc1 |
| InChI | InChI=1S/C21H21F2NO4/c1-2-27-20(26)14-17(15-8-4-3-5-9-15)24-19(25)13-12-16-10-6-7-11-18(16)28-21(22)23/h3-13,17,21H,2,14H2,1H3,(H,24,25)/b13-12+ |
| InChIKey | YGFMLCAQSQVIJS-OUKQBFOZSA-N |
| XLogP | 4.11 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|