C22H20F2N4O5S — CID 25440089
4-(difluoromethoxy)-3-methoxy-N-[2-[2-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)hydrazinyl]-2-oxoethyl]benzamide (PubChem CID 25440089) has the molecular formula C22H20F2N4O5S and a molecular weight of 490.49 g/mol. Its IUPAC name is 4-(difluoromethoxy)-3-methoxy-N-[2-[2-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)hydrazinyl]-2-oxoethyl]benzamide.
| Compound Name | 4-(difluoromethoxy)-3-methoxy-N-[2-[2-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)hydrazinyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 25440089 |
| Molecular Formula | C22H20F2N4O5S |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | 4-(difluoromethoxy)-3-methoxy-N-[2-[2-(4-methyl-2-phenyl-1,3-thiazole-5-carbonyl)hydrazinyl]-2-oxoethyl]benzamide |
| SMILES | COc1cc(C(=O)NCC(=O)NNC(=O)c2sc(-c3ccccc3)nc2C)ccc1OC(F)F |
| InChI | InChI=1S/C22H20F2N4O5S/c1-12-18(34-21(26-12)13-6-4-3-5-7-13)20(31)28-27-17(29)11-25-19(30)14-8-9-15(33-22(23)24)16(10-14)32-2/h3-10,22H,11H2,1-2H3,(H,25,30)(H,27,29)(H,28,31) |
| InChIKey | CSSZEOMVKFZFGV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 118.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|