C17H15F3N2O3 — CID 46699470
3-[[4-(2,2,2-trifluoroethoxymethyl)benzoyl]amino]benzamide (PubChem CID 46699470) has the molecular formula C17H15F3N2O3 and a molecular weight of 352.31 g/mol. Its IUPAC name is 3-[[4-(2,2,2-trifluoroethoxymethyl)benzoyl]amino]benzamide.
| Compound Name | 3-[[4-(2,2,2-trifluoroethoxymethyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 46699470 |
| Molecular Formula | C17H15F3N2O3 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 3-[[4-(2,2,2-trifluoroethoxymethyl)benzoyl]amino]benzamide |
| SMILES | NC(=O)c1cccc(NC(=O)c2ccc(COCC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C17H15F3N2O3/c18-17(19,20)10-25-9-11-4-6-12(7-5-11)16(24)22-14-3-1-2-13(8-14)15(21)23/h1-8H,9-10H2,(H2,21,23)(H,22,24) |
| InChIKey | BOIJTXZVWJVHSL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |