C10H10F3NO2 — CID 91641393
4-(2,2,2-trifluoroethoxymethyl)benzamide (PubChem CID 91641393) has the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. Its IUPAC name is 4-(2,2,2-trifluoroethoxymethyl)benzamide.
| Compound Name | 4-(2,2,2-trifluoroethoxymethyl)benzamide |
|---|---|
| PubChem CID | 91641393 |
| Molecular Formula | C10H10F3NO2 |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 4-(2,2,2-trifluoroethoxymethyl)benzamide |
| SMILES | NC(=O)c1ccc(COCC(F)(F)F)cc1 |
| InChI | InChI=1S/C10H10F3NO2/c11-10(12,13)6-16-5-7-1-3-8(4-2-7)9(14)15/h1-4H,5-6H2,(H2,14,15) |
| InChIKey | VILVMBJQQVUTGE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |