C20H21F3N4O4 — CID 3925153
2-[2-[2-[4-(dimethylamino)benzoyl]hydrazinyl]-2-oxoethoxy]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 3925153) has the molecular formula C20H21F3N4O4 and a molecular weight of 438.41 g/mol. Its IUPAC name is 2-[2-[2-[4-(dimethylamino)benzoyl]hydrazinyl]-2-oxoethoxy]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[2-[2-[4-(dimethylamino)benzoyl]hydrazinyl]-2-oxoethoxy]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 3925153 |
| Molecular Formula | C20H21F3N4O4 |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 2-[2-[2-[4-(dimethylamino)benzoyl]hydrazinyl]-2-oxoethoxy]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CN(C)c1ccc(C(=O)NNC(=O)COCC(=O)Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H21F3N4O4/c1-27(2)16-8-6-13(7-9-16)19(30)26-25-18(29)12-31-11-17(28)24-15-5-3-4-14(10-15)20(21,22)23/h3-10H,11-12H2,1-2H3,(H,24,28)(H,25,29)(H,26,30) |
| InChIKey | LLWKAXQVIIMTIX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|