C21H16Cl4N2O2S — CID 10228881
1-(3,5-dichlorophenyl)-3-[3-[(3,5-dichlorophenyl)methoxy]-4-methoxyphenyl]thiourea (PubChem CID 10228881) has the molecular formula C21H16Cl4N2O2S and a molecular weight of 502.25 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-[3-[(3,5-dichlorophenyl)methoxy]-4-methoxyphenyl]thiourea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-[3-[(3,5-dichlorophenyl)methoxy]-4-methoxyphenyl]thiourea |
|---|---|
| PubChem CID | 10228881 |
| Molecular Formula | C21H16Cl4N2O2S |
| Molecular Weight | 502.25 g/mol |
| Exact Mass | 499.97 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-[3-[(3,5-dichlorophenyl)methoxy]-4-methoxyphenyl]thiourea |
| SMILES | COc1ccc(NC(=S)Nc2cc(Cl)cc(Cl)c2)cc1OCc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C21H16Cl4N2O2S/c1-28-19-3-2-17(26-21(30)27-18-8-15(24)7-16(25)9-18)10-20(19)29-11-12-4-13(22)6-14(23)5-12/h2-10H,11H2,1H3,(H2,26,27,30) |
| InChIKey | PRJHKFVUYKXOOL-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.25 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|