C21H19ClN4O4S — CID 33156080
N-[4-(carbamoylamino)phenyl]-2-chloro-5-[(3-methylphenyl)sulfamoyl]benzamide (PubChem CID 33156080) has the molecular formula C21H19ClN4O4S and a molecular weight of 458.93 g/mol. Its IUPAC name is N-[4-(carbamoylamino)phenyl]-2-chloro-5-[(3-methylphenyl)sulfamoyl]benzamide.
| Compound Name | N-[4-(carbamoylamino)phenyl]-2-chloro-5-[(3-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 33156080 |
| Molecular Formula | C21H19ClN4O4S |
| Molecular Weight | 458.93 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | N-[4-(carbamoylamino)phenyl]-2-chloro-5-[(3-methylphenyl)sulfamoyl]benzamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2ccc(Cl)c(C(=O)Nc3ccc(NC(N)=O)cc3)c2)c1 |
| InChI | InChI=1S/C21H19ClN4O4S/c1-13-3-2-4-16(11-13)26-31(29,30)17-9-10-19(22)18(12-17)20(27)24-14-5-7-15(8-6-14)25-21(23)28/h2-12,26H,1H3,(H,24,27)(H3,23,25,28) |
| InChIKey | BQWYFCUFSZGXAB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.93 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |