C22H20N4O5S2 — CID 89096368
N-[[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]carbamothioyl]-2-nitrosobenzamide (PubChem CID 89096368) has the molecular formula C22H20N4O5S2 and a molecular weight of 484.56 g/mol. Its IUPAC name is N-[[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]carbamothioyl]-2-nitrosobenzamide.
| Compound Name | N-[[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]carbamothioyl]-2-nitrosobenzamide |
|---|---|
| PubChem CID | 89096368 |
| Molecular Formula | C22H20N4O5S2 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | N-[[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]carbamothioyl]-2-nitrosobenzamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)c3ccccc3N=O)cc2)cc1 |
| InChI | InChI=1S/C22H20N4O5S2/c1-2-31-17-11-7-16(8-12-17)26-33(29,30)18-13-9-15(10-14-18)23-22(32)24-21(27)19-5-3-4-6-20(19)25-28/h3-14,26H,2H2,1H3,(H2,23,24,27,32) |
| InChIKey | LWZSSFKBYZQUES-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 125.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|