C22H23ClN4O3S — CID 6134644
N-[4-[[[(E)-3-(2-chlorophenyl)prop-2-enoyl]carbamothioylamino]carbamoyl]phenyl]-3-methylbutanamide (PubChem CID 6134644) has the molecular formula C22H23ClN4O3S and a molecular weight of 458.97 g/mol. Its IUPAC name is N-[4-[[[(E)-3-(2-chlorophenyl)prop-2-enoyl]carbamothioylamino]carbamoyl]phenyl]-3-methylbutanamide.
| Compound Name | N-[4-[[[(E)-3-(2-chlorophenyl)prop-2-enoyl]carbamothioylamino]carbamoyl]phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 6134644 |
| Molecular Formula | C22H23ClN4O3S |
| Molecular Weight | 458.97 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | N-[4-[[[(E)-3-(2-chlorophenyl)prop-2-enoyl]carbamothioylamino]carbamoyl]phenyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)Nc1ccc(C(=O)NNC(=S)NC(=O)/C=C/c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C22H23ClN4O3S/c1-14(2)13-20(29)24-17-10-7-16(8-11-17)21(30)26-27-22(31)25-19(28)12-9-15-5-3-4-6-18(15)23/h3-12,14H,13H2,1-2H3,(H,24,29)(H,26,30)(H2,25,27,28,31)/b12-9+ |
| InChIKey | UMSHOMVYHJSJFO-FMIVXFBMSA-N |
| XLogP | 3.67 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.97 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|