C16H13Cl2IN2OS — CID 23097760
2,5-dichloro-N-[(4-iodo-2,5-dimethylphenyl)carbamothioyl]benzamide (PubChem CID 23097760) has the molecular formula C16H13Cl2IN2OS and a molecular weight of 479.17 g/mol. Its IUPAC name is 2,5-dichloro-N-[(4-iodo-2,5-dimethylphenyl)carbamothioyl]benzamide.
| Compound Name | 2,5-dichloro-N-[(4-iodo-2,5-dimethylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 23097760 |
| Molecular Formula | C16H13Cl2IN2OS |
| Molecular Weight | 479.17 g/mol |
| Exact Mass | 477.92 |
| IUPAC Name | 2,5-dichloro-N-[(4-iodo-2,5-dimethylphenyl)carbamothioyl]benzamide |
| SMILES | Cc1cc(NC(=S)NC(=O)c2cc(Cl)ccc2Cl)c(C)cc1I |
| InChI | InChI=1S/C16H13Cl2IN2OS/c1-8-6-14(9(2)5-13(8)19)20-16(23)21-15(22)11-7-10(17)3-4-12(11)18/h3-7H,1-2H3,(H2,20,21,22,23) |
| InChIKey | WHQYMIXFNNRODG-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.17 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|