C15H12ClIN2OS — CID 1334183
4-chloro-N-[(4-iodo-2-methylphenyl)carbamothioyl]benzamide (PubChem CID 1334183) has the molecular formula C15H12ClIN2OS and a molecular weight of 430.70 g/mol. Its IUPAC name is 4-chloro-N-[(4-iodo-2-methylphenyl)carbamothioyl]benzamide.
| Compound Name | 4-chloro-N-[(4-iodo-2-methylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 1334183 |
| Molecular Formula | C15H12ClIN2OS |
| Molecular Weight | 430.70 g/mol |
| Exact Mass | 429.94 |
| IUPAC Name | 4-chloro-N-[(4-iodo-2-methylphenyl)carbamothioyl]benzamide |
| SMILES | Cc1cc(I)ccc1NC(=S)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H12ClIN2OS/c1-9-8-12(17)6-7-13(9)18-15(21)19-14(20)10-2-4-11(16)5-3-10/h2-8H,1H3,(H2,18,19,20,21) |
| InChIKey | WSRDNPIZOMNDJK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.70 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|