C15H11ClIN3O3S — CID 17115404
N-[(5-chloro-2-methyl-4-nitrophenyl)carbamothioyl]-4-iodobenzamide (PubChem CID 17115404) has the molecular formula C15H11ClIN3O3S and a molecular weight of 475.70 g/mol. Its IUPAC name is N-[(5-chloro-2-methyl-4-nitrophenyl)carbamothioyl]-4-iodobenzamide.
| Compound Name | N-[(5-chloro-2-methyl-4-nitrophenyl)carbamothioyl]-4-iodobenzamide |
|---|---|
| PubChem CID | 17115404 |
| Molecular Formula | C15H11ClIN3O3S |
| Molecular Weight | 475.70 g/mol |
| Exact Mass | 474.93 |
| IUPAC Name | N-[(5-chloro-2-methyl-4-nitrophenyl)carbamothioyl]-4-iodobenzamide |
| SMILES | Cc1cc([N+](=O)[O-])c(Cl)cc1NC(=S)NC(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C15H11ClIN3O3S/c1-8-6-13(20(22)23)11(16)7-12(8)18-15(24)19-14(21)9-2-4-10(17)5-3-9/h2-7H,1H3,(H2,18,19,21,24) |
| InChIKey | WEWZKGRRABUWDE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.70 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|