C15H10Cl2IN3O3S — CID 17115403
2-chloro-N-[(5-chloro-2-methyl-4-nitrophenyl)carbamothioyl]-5-iodobenzamide (PubChem CID 17115403) has the molecular formula C15H10Cl2IN3O3S and a molecular weight of 510.14 g/mol. Its IUPAC name is 2-chloro-N-[(5-chloro-2-methyl-4-nitrophenyl)carbamothioyl]-5-iodobenzamide.
| Compound Name | 2-chloro-N-[(5-chloro-2-methyl-4-nitrophenyl)carbamothioyl]-5-iodobenzamide |
|---|---|
| PubChem CID | 17115403 |
| Molecular Formula | C15H10Cl2IN3O3S |
| Molecular Weight | 510.14 g/mol |
| Exact Mass | 508.89 |
| IUPAC Name | 2-chloro-N-[(5-chloro-2-methyl-4-nitrophenyl)carbamothioyl]-5-iodobenzamide |
| SMILES | Cc1cc([N+](=O)[O-])c(Cl)cc1NC(=S)NC(=O)c1cc(I)ccc1Cl |
| InChI | InChI=1S/C15H10Cl2IN3O3S/c1-7-4-13(21(23)24)11(17)6-12(7)19-15(25)20-14(22)9-5-8(18)2-3-10(9)16/h2-6H,1H3,(H2,19,20,22,25) |
| InChIKey | YKPOMMCBCIBMBX-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.14 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|