C24H22Cl2N2O3 — CID 17111488
(E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[4-(morpholin-4-ylmethyl)phenyl]prop-2-enamide (PubChem CID 17111488) has the molecular formula C24H22Cl2N2O3 and a molecular weight of 457.36 g/mol. Its IUPAC name is (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[4-(morpholin-4-ylmethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[4-(morpholin-4-ylmethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 17111488 |
| Molecular Formula | C24H22Cl2N2O3 |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[4-(morpholin-4-ylmethyl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2ccc(Cl)cc2Cl)o1)Nc1ccc(CN2CCOCC2)cc1 |
| InChI | InChI=1S/C24H22Cl2N2O3/c25-18-3-8-21(22(26)15-18)23-9-6-20(31-23)7-10-24(29)27-19-4-1-17(2-5-19)16-28-11-13-30-14-12-28/h1-10,15H,11-14,16H2,(H,27,29)/b10-7+ |
| InChIKey | DEDQFQWVPQEOGC-JXMROGBWSA-N |
| XLogP | 5.74 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|