C16H20N4O5S — CID 113039736
2,4-dimethoxy-N-(6-morpholin-4-ylpyridazin-3-yl)benzenesulfonamide (PubChem CID 113039736) has the molecular formula C16H20N4O5S and a molecular weight of 380.43 g/mol. Its IUPAC name is 2,4-dimethoxy-N-(6-morpholin-4-ylpyridazin-3-yl)benzenesulfonamide.
| Compound Name | 2,4-dimethoxy-N-(6-morpholin-4-ylpyridazin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 113039736 |
| Molecular Formula | C16H20N4O5S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 2,4-dimethoxy-N-(6-morpholin-4-ylpyridazin-3-yl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(N3CCOCC3)nn2)c(OC)c1 |
| InChI | InChI=1S/C16H20N4O5S/c1-23-12-3-4-14(13(11-12)24-2)26(21,22)19-15-5-6-16(18-17-15)20-7-9-25-10-8-20/h3-6,11H,7-10H2,1-2H3,(H,17,19) |
| InChIKey | MZSWSBXTALRNAE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 102.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |