C18H23N3O4S — CID 113010011
2,4-dimethoxy-N-(6-piperidin-1-yl-3-pyridinyl)benzenesulfonamide (PubChem CID 113010011) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is 2,4-dimethoxy-N-(6-piperidin-1-yl-3-pyridinyl)benzenesulfonamide.
| Compound Name | 2,4-dimethoxy-N-(6-piperidin-1-yl-3-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 113010011 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 2,4-dimethoxy-N-(6-piperidin-1-yl-3-pyridinyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(N3CCCCC3)nc2)c(OC)c1 |
| InChI | InChI=1S/C18H23N3O4S/c1-24-15-7-8-17(16(12-15)25-2)26(22,23)20-14-6-9-18(19-13-14)21-10-4-3-5-11-21/h6-9,12-13,20H,3-5,10-11H2,1-2H3 |
| InChIKey | HRPXRQVOIXCWIK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |