C19H25N3O4S — CID 113010132
N-[6-(cyclohexylamino)-3-pyridinyl]-2,4-dimethoxybenzenesulfonamide (PubChem CID 113010132) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is N-[6-(cyclohexylamino)-3-pyridinyl]-2,4-dimethoxybenzenesulfonamide.
| Compound Name | N-[6-(cyclohexylamino)-3-pyridinyl]-2,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 113010132 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | N-[6-(cyclohexylamino)-3-pyridinyl]-2,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(NC3CCCCC3)nc2)c(OC)c1 |
| InChI | InChI=1S/C19H25N3O4S/c1-25-16-9-10-18(17(12-16)26-2)27(23,24)22-15-8-11-19(20-13-15)21-14-6-4-3-5-7-14/h8-14,22H,3-7H2,1-2H3,(H,20,21) |
| InChIKey | ZBQNJRTXQKWKNB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |