C20H27N3O3S — CID 113015961
N-[6-(azepan-1-yl)-3-pyridinyl]-4-methoxy-2,5-dimethylbenzenesulfonamide (PubChem CID 113015961) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is N-[6-(azepan-1-yl)-3-pyridinyl]-4-methoxy-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-[6-(azepan-1-yl)-3-pyridinyl]-4-methoxy-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 113015961 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | N-[6-(azepan-1-yl)-3-pyridinyl]-4-methoxy-2,5-dimethylbenzenesulfonamide |
| SMILES | COc1cc(C)c(S(=O)(=O)Nc2ccc(N3CCCCCC3)nc2)cc1C |
| InChI | InChI=1S/C20H27N3O3S/c1-15-13-19(16(2)12-18(15)26-3)27(24,25)22-17-8-9-20(21-14-17)23-10-6-4-5-7-11-23/h8-9,12-14,22H,4-7,10-11H2,1-3H3 |
| InChIKey | HKRYNOMTOCTXOR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |