C15H17ClN4O4S — CID 113039759
5-chloro-2-methoxy-N-(6-morpholin-4-ylpyridazin-3-yl)benzenesulfonamide (PubChem CID 113039759) has the molecular formula C15H17ClN4O4S and a molecular weight of 384.85 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-(6-morpholin-4-ylpyridazin-3-yl)benzenesulfonamide.
| Compound Name | 5-chloro-2-methoxy-N-(6-morpholin-4-ylpyridazin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 113039759 |
| Molecular Formula | C15H17ClN4O4S |
| Molecular Weight | 384.85 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 5-chloro-2-methoxy-N-(6-morpholin-4-ylpyridazin-3-yl)benzenesulfonamide |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)Nc1ccc(N2CCOCC2)nn1 |
| InChI | InChI=1S/C15H17ClN4O4S/c1-23-12-3-2-11(16)10-13(12)25(21,22)19-14-4-5-15(18-17-14)20-6-8-24-9-7-20/h2-5,10H,6-9H2,1H3,(H,17,19) |
| InChIKey | RLECXJPPKXAYHH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.85 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |