C18H15Cl2NO6S — CID 3997815
(2-oxooxolan-3-yl) 2,4-dichloro-5-[(3-methylphenyl)sulfamoyl]benzoate (PubChem CID 3997815) has the molecular formula C18H15Cl2NO6S and a molecular weight of 444.29 g/mol. Its IUPAC name is (2-oxooxolan-3-yl) 2,4-dichloro-5-[(3-methylphenyl)sulfamoyl]benzoate.
| Compound Name | (2-oxooxolan-3-yl) 2,4-dichloro-5-[(3-methylphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 3997815 |
| Molecular Formula | C18H15Cl2NO6S |
| Molecular Weight | 444.29 g/mol |
| Exact Mass | 443.00 |
| IUPAC Name | (2-oxooxolan-3-yl) 2,4-dichloro-5-[(3-methylphenyl)sulfamoyl]benzoate |
| SMILES | Cc1cccc(NS(=O)(=O)c2cc(C(=O)OC3CCOC3=O)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C18H15Cl2NO6S/c1-10-3-2-4-11(7-10)21-28(24,25)16-8-12(13(19)9-14(16)20)17(22)27-15-5-6-26-18(15)23/h2-4,7-9,15,21H,5-6H2,1H3 |
| InChIKey | IGWYJJVSDSOVED-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.29 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |