C19H19NO7S — CID 25047929
(2-oxooxolan-3-yl) 2-[(4-ethoxyphenyl)sulfonylamino]benzoate (PubChem CID 25047929) has the molecular formula C19H19NO7S and a molecular weight of 405.43 g/mol. Its IUPAC name is (2-oxooxolan-3-yl) 2-[(4-ethoxyphenyl)sulfonylamino]benzoate.
| Compound Name | (2-oxooxolan-3-yl) 2-[(4-ethoxyphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 25047929 |
| Molecular Formula | C19H19NO7S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | (2-oxooxolan-3-yl) 2-[(4-ethoxyphenyl)sulfonylamino]benzoate |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccccc2C(=O)OC2CCOC2=O)cc1 |
| InChI | InChI=1S/C19H19NO7S/c1-2-25-13-7-9-14(10-8-13)28(23,24)20-16-6-4-3-5-15(16)18(21)27-17-11-12-26-19(17)22/h3-10,17,20H,2,11-12H2,1H3 |
| InChIKey | ZQEUWGNUNDPOIP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |