C27H31N3O7S2 — CID 43875221
4-methoxy-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]-3-(2-phenylethylsulfamoyl)benzamide (PubChem CID 43875221) has the molecular formula C27H31N3O7S2 and a molecular weight of 573.69 g/mol. Its IUPAC name is 4-methoxy-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]-3-(2-phenylethylsulfamoyl)benzamide.
| Compound Name | 4-methoxy-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]-3-(2-phenylethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 43875221 |
| Molecular Formula | C27H31N3O7S2 |
| Molecular Weight | 573.69 g/mol |
| Exact Mass | 573.16 |
| IUPAC Name | 4-methoxy-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]-3-(2-phenylethylsulfamoyl)benzamide |
| SMILES | COc1ccc(C(=O)NCc2ccc(S(=O)(=O)N3CCOCC3)cc2)cc1S(=O)(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C27H31N3O7S2/c1-36-25-12-9-23(19-26(25)38(32,33)29-14-13-21-5-3-2-4-6-21)27(31)28-20-22-7-10-24(11-8-22)39(34,35)30-15-17-37-18-16-30/h2-12,19,29H,13-18,20H2,1H3,(H,28,31) |
| InChIKey | XKEDBUFPSNNIFC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.69 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |