C21H27N3O7S2 — CID 27861838
3-(dimethylsulfamoyl)-4-methoxy-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]benzamide (PubChem CID 27861838) has the molecular formula C21H27N3O7S2 and a molecular weight of 497.60 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-4-methoxy-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]benzamide.
| Compound Name | 3-(dimethylsulfamoyl)-4-methoxy-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 27861838 |
| Molecular Formula | C21H27N3O7S2 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 3-(dimethylsulfamoyl)-4-methoxy-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]benzamide |
| SMILES | COc1ccc(C(=O)NCc2ccc(S(=O)(=O)N3CCOCC3)cc2)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C21H27N3O7S2/c1-23(2)33(28,29)20-14-17(6-9-19(20)30-3)21(25)22-15-16-4-7-18(8-5-16)32(26,27)24-10-12-31-13-11-24/h4-9,14H,10-13,15H2,1-3H3,(H,22,25) |
| InChIKey | OSWLJYNWJLFLSQ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |