C19H28N2O5S — CID 119230116
4-[[5-(diethylsulfamoyl)-2-methylbenzoyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 119230116) has the molecular formula C19H28N2O5S and a molecular weight of 396.51 g/mol. Its IUPAC name is 4-[[5-(diethylsulfamoyl)-2-methylbenzoyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[5-(diethylsulfamoyl)-2-methylbenzoyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 119230116 |
| Molecular Formula | C19H28N2O5S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 4-[[5-(diethylsulfamoyl)-2-methylbenzoyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C)c(C(=O)NC2CCC(C(=O)O)CC2)c1 |
| InChI | InChI=1S/C19H28N2O5S/c1-4-21(5-2)27(25,26)16-11-6-13(3)17(12-16)18(22)20-15-9-7-14(8-10-15)19(23)24/h6,11-12,14-15H,4-5,7-10H2,1-3H3,(H,20,22)(H,23,24) |
| InChIKey | NJDVMJSNBYVING-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |