C18H30ClN3O3S — CID 120577294
5-(diethylsulfamoyl)-2-methyl-N-(2-methylpiperidin-3-yl)benzamide;hydrochloride (PubChem CID 120577294) has the molecular formula C18H30ClN3O3S and a molecular weight of 403.98 g/mol. Its IUPAC name is 5-(diethylsulfamoyl)-2-methyl-N-(2-methylpiperidin-3-yl)benzamide;hydrochloride.
| Compound Name | 5-(diethylsulfamoyl)-2-methyl-N-(2-methylpiperidin-3-yl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 120577294 |
| Molecular Formula | C18H30ClN3O3S |
| Molecular Weight | 403.98 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 5-(diethylsulfamoyl)-2-methyl-N-(2-methylpiperidin-3-yl)benzamide;hydrochloride |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C)c(C(=O)NC2CCCNC2C)c1.Cl |
| InChI | InChI=1S/C18H29N3O3S.ClH/c1-5-21(6-2)25(23,24)15-10-9-13(3)16(12-15)18(22)20-17-8-7-11-19-14(17)4;/h9-10,12,14,17,19H,5-8,11H2,1-4H3,(H,20,22);1H |
| InChIKey | FRKITOFSAWQUNM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.98 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |