C26H33N5O3S — CID 3219957
4-[4-(5-methylbenzotriazol-1-yl)piperidin-1-yl]sulfonyl-N-(2-methylcyclohexyl)benzamide (PubChem CID 3219957) has the molecular formula C26H33N5O3S and a molecular weight of 495.65 g/mol. Its IUPAC name is 4-[4-(5-methylbenzotriazol-1-yl)piperidin-1-yl]sulfonyl-N-(2-methylcyclohexyl)benzamide.
| Compound Name | 4-[4-(5-methylbenzotriazol-1-yl)piperidin-1-yl]sulfonyl-N-(2-methylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 3219957 |
| Molecular Formula | C26H33N5O3S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 4-[4-(5-methylbenzotriazol-1-yl)piperidin-1-yl]sulfonyl-N-(2-methylcyclohexyl)benzamide |
| SMILES | Cc1ccc2c(c1)nnn2C1CCN(S(=O)(=O)c2ccc(C(=O)NC3CCCCC3C)cc2)CC1 |
| InChI | InChI=1S/C26H33N5O3S/c1-18-7-12-25-24(17-18)28-29-31(25)21-13-15-30(16-14-21)35(33,34)22-10-8-20(9-11-22)26(32)27-23-6-4-3-5-19(23)2/h7-12,17,19,21,23H,3-6,13-16H2,1-2H3,(H,27,32) |
| InChIKey | VZULOMOOPHFLIC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |