C19H21ClN4O2S — CID 1469697
1-[1-(5-chloro-2-methylphenyl)sulfonylpiperidin-4-yl]-5-methylbenzotriazole (PubChem CID 1469697) has the molecular formula C19H21ClN4O2S and a molecular weight of 404.92 g/mol. Its IUPAC name is 1-[1-(5-chloro-2-methylphenyl)sulfonylpiperidin-4-yl]-5-methylbenzotriazole.
| Compound Name | 1-[1-(5-chloro-2-methylphenyl)sulfonylpiperidin-4-yl]-5-methylbenzotriazole |
|---|---|
| PubChem CID | 1469697 |
| Molecular Formula | C19H21ClN4O2S |
| Molecular Weight | 404.92 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 1-[1-(5-chloro-2-methylphenyl)sulfonylpiperidin-4-yl]-5-methylbenzotriazole |
| SMILES | Cc1ccc2c(c1)nnn2C1CCN(S(=O)(=O)c2cc(Cl)ccc2C)CC1 |
| InChI | InChI=1S/C19H21ClN4O2S/c1-13-3-6-18-17(11-13)21-22-24(18)16-7-9-23(10-8-16)27(25,26)19-12-15(20)5-4-14(19)2/h3-6,11-12,16H,7-10H2,1-2H3 |
| InChIKey | ILPSMQMWLFMSOX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.92 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |