C21H32N4O3S2 — CID 55350376
1-(2-methylcyclohexyl)-3-[(4-methyl-3-piperidin-1-ylsulfonylbenzoyl)amino]thiourea (PubChem CID 55350376) has the molecular formula C21H32N4O3S2 and a molecular weight of 452.65 g/mol. Its IUPAC name is 1-(2-methylcyclohexyl)-3-[(4-methyl-3-piperidin-1-ylsulfonylbenzoyl)amino]thiourea.
| Compound Name | 1-(2-methylcyclohexyl)-3-[(4-methyl-3-piperidin-1-ylsulfonylbenzoyl)amino]thiourea |
|---|---|
| PubChem CID | 55350376 |
| Molecular Formula | C21H32N4O3S2 |
| Molecular Weight | 452.65 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 1-(2-methylcyclohexyl)-3-[(4-methyl-3-piperidin-1-ylsulfonylbenzoyl)amino]thiourea |
| SMILES | Cc1ccc(C(=O)NNC(=S)NC2CCCCC2C)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C21H32N4O3S2/c1-15-8-4-5-9-18(15)22-21(29)24-23-20(26)17-11-10-16(2)19(14-17)30(27,28)25-12-6-3-7-13-25/h10-11,14-15,18H,3-9,12-13H2,1-2H3,(H,23,26)(H2,22,24,29) |
| InChIKey | DFLQZGNNHKGISM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.65 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|