C22H26ClN3O6S — CID 26620956
N'-(2-chloro-5-piperidin-1-ylsulfonylbenzoyl)-4-ethoxy-3-methoxybenzohydrazide (PubChem CID 26620956) has the molecular formula C22H26ClN3O6S and a molecular weight of 495.99 g/mol. Its IUPAC name is N'-(2-chloro-5-piperidin-1-ylsulfonylbenzoyl)-4-ethoxy-3-methoxybenzohydrazide.
| Compound Name | N'-(2-chloro-5-piperidin-1-ylsulfonylbenzoyl)-4-ethoxy-3-methoxybenzohydrazide |
|---|---|
| PubChem CID | 26620956 |
| Molecular Formula | C22H26ClN3O6S |
| Molecular Weight | 495.99 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | N'-(2-chloro-5-piperidin-1-ylsulfonylbenzoyl)-4-ethoxy-3-methoxybenzohydrazide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)c2cc(S(=O)(=O)N3CCCCC3)ccc2Cl)cc1OC |
| InChI | InChI=1S/C22H26ClN3O6S/c1-3-32-19-10-7-15(13-20(19)31-2)21(27)24-25-22(28)17-14-16(8-9-18(17)23)33(29,30)26-11-5-4-6-12-26/h7-10,13-14H,3-6,11-12H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | KFTYUFAOZHPZCT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.99 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|