C19H19Cl2N3O4S — CID 55348670
2-chloro-N'-[2-(4-chlorophenyl)acetyl]-5-pyrrolidin-1-ylsulfonylbenzohydrazide (PubChem CID 55348670) has the molecular formula C19H19Cl2N3O4S and a molecular weight of 456.35 g/mol. Its IUPAC name is 2-chloro-N'-[2-(4-chlorophenyl)acetyl]-5-pyrrolidin-1-ylsulfonylbenzohydrazide.
| Compound Name | 2-chloro-N'-[2-(4-chlorophenyl)acetyl]-5-pyrrolidin-1-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 55348670 |
| Molecular Formula | C19H19Cl2N3O4S |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 455.05 |
| IUPAC Name | 2-chloro-N'-[2-(4-chlorophenyl)acetyl]-5-pyrrolidin-1-ylsulfonylbenzohydrazide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NNC(=O)c1cc(S(=O)(=O)N2CCCC2)ccc1Cl |
| InChI | InChI=1S/C19H19Cl2N3O4S/c20-14-5-3-13(4-6-14)11-18(25)22-23-19(26)16-12-15(7-8-17(16)21)29(27,28)24-9-1-2-10-24/h3-8,12H,1-2,9-11H2,(H,22,25)(H,23,26) |
| InChIKey | MTDTVAKFULPDMJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|