C19H20Cl2N2O3S2 — CID 26374148
2-chloro-N-[2-(4-chlorophenyl)sulfanylethyl]-5-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 26374148) has the molecular formula C19H20Cl2N2O3S2 and a molecular weight of 459.42 g/mol. Its IUPAC name is 2-chloro-N-[2-(4-chlorophenyl)sulfanylethyl]-5-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 2-chloro-N-[2-(4-chlorophenyl)sulfanylethyl]-5-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 26374148 |
| Molecular Formula | C19H20Cl2N2O3S2 |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | 2-chloro-N-[2-(4-chlorophenyl)sulfanylethyl]-5-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NCCSc1ccc(Cl)cc1)c1cc(S(=O)(=O)N2CCCC2)ccc1Cl |
| InChI | InChI=1S/C19H20Cl2N2O3S2/c20-14-3-5-15(6-4-14)27-12-9-22-19(24)17-13-16(7-8-18(17)21)28(25,26)23-10-1-2-11-23/h3-8,13H,1-2,9-12H2,(H,22,24) |
| InChIKey | MAAYMFRRMYVYBL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|