C26H34ClN3O3S — CID 46767784
5-(azepan-1-ylsulfonyl)-2-chloro-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]benzamide (PubChem CID 46767784) has the molecular formula C26H34ClN3O3S and a molecular weight of 504.10 g/mol. Its IUPAC name is 5-(azepan-1-ylsulfonyl)-2-chloro-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]benzamide.
| Compound Name | 5-(azepan-1-ylsulfonyl)-2-chloro-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 46767784 |
| Molecular Formula | C26H34ClN3O3S |
| Molecular Weight | 504.10 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | 5-(azepan-1-ylsulfonyl)-2-chloro-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(CN2CCCCC2)cc1)c1cc(S(=O)(=O)N2CCCCCC2)ccc1Cl |
| InChI | InChI=1S/C26H34ClN3O3S/c27-25-13-12-23(34(32,33)30-16-6-1-2-7-17-30)18-24(25)26(31)28-19-21-8-10-22(11-9-21)20-29-14-4-3-5-15-29/h8-13,18H,1-7,14-17,19-20H2,(H,28,31) |
| InChIKey | HBEOLXCSIMAEBR-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.10 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |