C21H25ClN4O4S2 — CID 26858237
1-[(2-chloro-5-piperidin-1-ylsulfonylbenzoyl)amino]-3-[(4-methoxyphenyl)methyl]thiourea (PubChem CID 26858237) has the molecular formula C21H25ClN4O4S2 and a molecular weight of 497.04 g/mol. Its IUPAC name is 1-[(2-chloro-5-piperidin-1-ylsulfonylbenzoyl)amino]-3-[(4-methoxyphenyl)methyl]thiourea.
| Compound Name | 1-[(2-chloro-5-piperidin-1-ylsulfonylbenzoyl)amino]-3-[(4-methoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 26858237 |
| Molecular Formula | C21H25ClN4O4S2 |
| Molecular Weight | 497.04 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | 1-[(2-chloro-5-piperidin-1-ylsulfonylbenzoyl)amino]-3-[(4-methoxyphenyl)methyl]thiourea |
| SMILES | COc1ccc(CNC(=S)NNC(=O)c2cc(S(=O)(=O)N3CCCCC3)ccc2Cl)cc1 |
| InChI | InChI=1S/C21H25ClN4O4S2/c1-30-16-7-5-15(6-8-16)14-23-21(31)25-24-20(27)18-13-17(9-10-19(18)22)32(28,29)26-11-3-2-4-12-26/h5-10,13H,2-4,11-12,14H2,1H3,(H,24,27)(H2,23,25,31) |
| InChIKey | PTFLXBDMRYPOPH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.04 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|