C23H28F3N3O3S — CID 16558784
5-(dimethylsulfamoyl)-2-piperidin-1-yl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]benzamide (PubChem CID 16558784) has the molecular formula C23H28F3N3O3S and a molecular weight of 483.56 g/mol. Its IUPAC name is 5-(dimethylsulfamoyl)-2-piperidin-1-yl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]benzamide.
| Compound Name | 5-(dimethylsulfamoyl)-2-piperidin-1-yl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 16558784 |
| Molecular Formula | C23H28F3N3O3S |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 5-(dimethylsulfamoyl)-2-piperidin-1-yl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]benzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(N2CCCCC2)c(C(=O)NCCc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C23H28F3N3O3S/c1-28(2)33(31,32)19-10-11-21(29-14-4-3-5-15-29)20(16-19)22(30)27-13-12-17-6-8-18(9-7-17)23(24,25)26/h6-11,16H,3-5,12-15H2,1-2H3,(H,27,30) |
| InChIKey | RVCXBQGFLIUYFK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |