C22H25ClN4O4S — CID 55481130
N-(4-chloro-3-cyanophenyl)-5-(diethylsulfamoyl)-2-morpholin-4-ylbenzamide (PubChem CID 55481130) has the molecular formula C22H25ClN4O4S and a molecular weight of 476.99 g/mol. Its IUPAC name is N-(4-chloro-3-cyanophenyl)-5-(diethylsulfamoyl)-2-morpholin-4-ylbenzamide.
| Compound Name | N-(4-chloro-3-cyanophenyl)-5-(diethylsulfamoyl)-2-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 55481130 |
| Molecular Formula | C22H25ClN4O4S |
| Molecular Weight | 476.99 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | N-(4-chloro-3-cyanophenyl)-5-(diethylsulfamoyl)-2-morpholin-4-ylbenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCOCC2)c(C(=O)Nc2ccc(Cl)c(C#N)c2)c1 |
| InChI | InChI=1S/C22H25ClN4O4S/c1-3-27(4-2)32(29,30)18-6-8-21(26-9-11-31-12-10-26)19(14-18)22(28)25-17-5-7-20(23)16(13-17)15-24/h5-8,13-14H,3-4,9-12H2,1-2H3,(H,25,28) |
| InChIKey | HYSRINHJCUAFIB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.99 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |