C17H13ClN4O4S — CID 9029572
N-[(Z)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-2-(4-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 9029572) has the molecular formula C17H13ClN4O4S and a molecular weight of 404.84 g/mol. Its IUPAC name is N-[(Z)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-2-(4-methyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | N-[(Z)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-2-(4-methyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 9029572 |
| Molecular Formula | C17H13ClN4O4S |
| Molecular Weight | 404.84 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | N-[(Z)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-2-(4-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | Cc1csc(CC(=O)N/N=C\c2ccc(-c3ccc([N+](=O)[O-])cc3Cl)o2)n1 |
| InChI | InChI=1S/C17H13ClN4O4S/c1-10-9-27-17(20-10)7-16(23)21-19-8-12-3-5-15(26-12)13-4-2-11(22(24)25)6-14(13)18/h2-6,8-9H,7H2,1H3,(H,21,23)/b19-8- |
| InChIKey | RUPYIJFAFOMUSU-UWVJOHFNSA-N |
| XLogP | 3.97 |
| TPSA | 110.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.84 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|