C27H22ClN3O4 — CID 26984922
(2R)-N-[(Z)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-3-(2-methylphenyl)-2-phenylpropanamide (PubChem CID 26984922) has the molecular formula C27H22ClN3O4 and a molecular weight of 487.94 g/mol. Its IUPAC name is (2R)-N-[(Z)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-3-(2-methylphenyl)-2-phenylpropanamide.
| Compound Name | (2R)-N-[(Z)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-3-(2-methylphenyl)-2-phenylpropanamide |
|---|---|
| PubChem CID | 26984922 |
| Molecular Formula | C27H22ClN3O4 |
| Molecular Weight | 487.94 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | (2R)-N-[(Z)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-3-(2-methylphenyl)-2-phenylpropanamide |
| SMILES | Cc1ccccc1C[C@@H](C(=O)N/N=C\c1ccc(-c2ccc([N+](=O)[O-])cc2Cl)o1)c1ccccc1 |
| InChI | InChI=1S/C27H22ClN3O4/c1-18-7-5-6-10-20(18)15-24(19-8-3-2-4-9-19)27(32)30-29-17-22-12-14-26(35-22)23-13-11-21(31(33)34)16-25(23)28/h2-14,16-17,24H,15H2,1H3,(H,30,32)/b29-17-/t24-/m1/s1 |
| InChIKey | HQENGQFKTVDOGB-WRIMGEDOSA-N |
| XLogP | 6.29 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.94 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|