C21H19FN2O3 — CID 6888998
2-(2,6-dimethylphenoxy)-N-[(E)-[5-(2-fluorophenyl)furan-2-yl]methylideneamino]acetamide (PubChem CID 6888998) has the molecular formula C21H19FN2O3 and a molecular weight of 366.39 g/mol. Its IUPAC name is 2-(2,6-dimethylphenoxy)-N-[(E)-[5-(2-fluorophenyl)furan-2-yl]methylideneamino]acetamide.
| Compound Name | 2-(2,6-dimethylphenoxy)-N-[(E)-[5-(2-fluorophenyl)furan-2-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 6888998 |
| Molecular Formula | C21H19FN2O3 |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 2-(2,6-dimethylphenoxy)-N-[(E)-[5-(2-fluorophenyl)furan-2-yl]methylideneamino]acetamide |
| SMILES | Cc1cccc(C)c1OCC(=O)N/N=C/c1ccc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C21H19FN2O3/c1-14-6-5-7-15(2)21(14)26-13-20(25)24-23-12-16-10-11-19(27-16)17-8-3-4-9-18(17)22/h3-12H,13H2,1-2H3,(H,24,25)/b23-12+ |
| InChIKey | PKHLOFGHVVSITB-FSJBWODESA-N |
| XLogP | 4.23 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|