C20H18BrFN2O2 — CID 1042800
N-[1-(4-bromophenyl)-3-oxo-3-pyrrolidin-1-ylprop-1-en-2-yl]-2-fluorobenzamide (PubChem CID 1042800) has the molecular formula C20H18BrFN2O2 and a molecular weight of 417.28 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)-3-oxo-3-pyrrolidin-1-ylprop-1-en-2-yl]-2-fluorobenzamide.
| Compound Name | N-[1-(4-bromophenyl)-3-oxo-3-pyrrolidin-1-ylprop-1-en-2-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 1042800 |
| Molecular Formula | C20H18BrFN2O2 |
| Molecular Weight | 417.28 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | N-[1-(4-bromophenyl)-3-oxo-3-pyrrolidin-1-ylprop-1-en-2-yl]-2-fluorobenzamide |
| SMILES | O=C(NC(=Cc1ccc(Br)cc1)C(=O)N1CCCC1)c1ccccc1F |
| InChI | InChI=1S/C20H18BrFN2O2/c21-15-9-7-14(8-10-15)13-18(20(26)24-11-3-4-12-24)23-19(25)16-5-1-2-6-17(16)22/h1-2,5-10,13H,3-4,11-12H2,(H,23,25) |
| InChIKey | MRWIXRGKPDWRDG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.28 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|