C22H23BrFN3O2 — CID 1022915
2-bromo-N-[1-(3-fluorophenyl)-3-(4-methyl-1,4-diazepan-1-yl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 1022915) has the molecular formula C22H23BrFN3O2 and a molecular weight of 460.35 g/mol. Its IUPAC name is 2-bromo-N-[1-(3-fluorophenyl)-3-(4-methyl-1,4-diazepan-1-yl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | 2-bromo-N-[1-(3-fluorophenyl)-3-(4-methyl-1,4-diazepan-1-yl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 1022915 |
| Molecular Formula | C22H23BrFN3O2 |
| Molecular Weight | 460.35 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 2-bromo-N-[1-(3-fluorophenyl)-3-(4-methyl-1,4-diazepan-1-yl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CN1CCCN(C(=O)C(=Cc2cccc(F)c2)NC(=O)c2ccccc2Br)CC1 |
| InChI | InChI=1S/C22H23BrFN3O2/c1-26-10-5-11-27(13-12-26)22(29)20(15-16-6-4-7-17(24)14-16)25-21(28)18-8-2-3-9-19(18)23/h2-4,6-9,14-15H,5,10-13H2,1H3,(H,25,28) |
| InChIKey | QQIYLQUKCGHBCP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|