C22H17BrFN3O2 — CID 5292082
2-bromo-N-[(Z)-1-(3-fluorophenyl)-3-oxo-3-(pyridin-3-ylmethylamino)prop-1-en-2-yl]benzamide (PubChem CID 5292082) has the molecular formula C22H17BrFN3O2 and a molecular weight of 454.30 g/mol. Its IUPAC name is 2-bromo-N-[(Z)-1-(3-fluorophenyl)-3-oxo-3-(pyridin-3-ylmethylamino)prop-1-en-2-yl]benzamide.
| Compound Name | 2-bromo-N-[(Z)-1-(3-fluorophenyl)-3-oxo-3-(pyridin-3-ylmethylamino)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 5292082 |
| Molecular Formula | C22H17BrFN3O2 |
| Molecular Weight | 454.30 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | 2-bromo-N-[(Z)-1-(3-fluorophenyl)-3-oxo-3-(pyridin-3-ylmethylamino)prop-1-en-2-yl]benzamide |
| SMILES | O=C(NCc1cccnc1)/C(=C/c1cccc(F)c1)NC(=O)c1ccccc1Br |
| InChI | InChI=1S/C22H17BrFN3O2/c23-19-9-2-1-8-18(19)21(28)27-20(12-15-5-3-7-17(24)11-15)22(29)26-14-16-6-4-10-25-13-16/h1-13H,14H2,(H,26,29)(H,27,28)/b20-12- |
| InChIKey | FVAGRHJTHXDIKW-NDENLUEZSA-N |
| XLogP | 4.07 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.30 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|