C21H19N3O4 — CID 57382769
N-[(Z)-1-(furan-2-yl)-3-oxo-3-(pyridin-3-ylmethylamino)prop-1-en-2-yl]-2-methoxybenzamide (PubChem CID 57382769) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is N-[(Z)-1-(furan-2-yl)-3-oxo-3-(pyridin-3-ylmethylamino)prop-1-en-2-yl]-2-methoxybenzamide.
| Compound Name | N-[(Z)-1-(furan-2-yl)-3-oxo-3-(pyridin-3-ylmethylamino)prop-1-en-2-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 57382769 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-[(Z)-1-(furan-2-yl)-3-oxo-3-(pyridin-3-ylmethylamino)prop-1-en-2-yl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)N/C(=C\c1ccco1)C(=O)NCc1cccnc1 |
| InChI | InChI=1S/C21H19N3O4/c1-27-19-9-3-2-8-17(19)20(25)24-18(12-16-7-5-11-28-16)21(26)23-14-15-6-4-10-22-13-15/h2-13H,14H2,1H3,(H,23,26)(H,24,25)/b18-12- |
| InChIKey | HEBYCUBGVIHGAV-PDGQHHTCSA-N |
| XLogP | 2.77 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|