C26H24N4O5 — CID 100765648
N-[(Z)-1-(furan-2-yl)-3-[(4-imidazol-1-ylphenyl)methylamino]-3-oxoprop-1-en-2-yl]-3,4-dimethoxybenzamide (PubChem CID 100765648) has the molecular formula C26H24N4O5 and a molecular weight of 472.50 g/mol. Its IUPAC name is N-[(Z)-1-(furan-2-yl)-3-[(4-imidazol-1-ylphenyl)methylamino]-3-oxoprop-1-en-2-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-[(Z)-1-(furan-2-yl)-3-[(4-imidazol-1-ylphenyl)methylamino]-3-oxoprop-1-en-2-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 100765648 |
| Molecular Formula | C26H24N4O5 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | N-[(Z)-1-(furan-2-yl)-3-[(4-imidazol-1-ylphenyl)methylamino]-3-oxoprop-1-en-2-yl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N/C(=C\c2ccco2)C(=O)NCc2ccc(-n3ccnc3)cc2)cc1OC |
| InChI | InChI=1S/C26H24N4O5/c1-33-23-10-7-19(14-24(23)34-2)25(31)29-22(15-21-4-3-13-35-21)26(32)28-16-18-5-8-20(9-6-18)30-12-11-27-17-30/h3-15,17H,16H2,1-2H3,(H,28,32)(H,29,31)/b22-15- |
| InChIKey | CGFKJWLAQJUMJH-JCMHNJIXSA-N |
| XLogP | 3.57 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|