C25H26N2O5 — CID 3350316
N-[3-[(3,4-dimethoxyphenyl)methylamino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]-3,4-dimethylbenzamide (PubChem CID 3350316) has the molecular formula C25H26N2O5 and a molecular weight of 434.49 g/mol. Its IUPAC name is N-[3-[(3,4-dimethoxyphenyl)methylamino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]-3,4-dimethylbenzamide.
| Compound Name | N-[3-[(3,4-dimethoxyphenyl)methylamino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 3350316 |
| Molecular Formula | C25H26N2O5 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | N-[3-[(3,4-dimethoxyphenyl)methylamino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]-3,4-dimethylbenzamide |
| SMILES | COc1ccc(CNC(=O)C(=Cc2ccco2)NC(=O)c2ccc(C)c(C)c2)cc1OC |
| InChI | InChI=1S/C25H26N2O5/c1-16-7-9-19(12-17(16)2)24(28)27-21(14-20-6-5-11-32-20)25(29)26-15-18-8-10-22(30-3)23(13-18)31-4/h5-14H,15H2,1-4H3,(H,26,29)(H,27,28) |
| InChIKey | DUVHXXCJFRRBTC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|