C21H20BrFN2O3 — CID 126477398
2-bromo-N-[(Z)-1-(3-fluorophenyl)-3-(4-hydroxypiperidin-1-yl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 126477398) has the molecular formula C21H20BrFN2O3 and a molecular weight of 447.30 g/mol. Its IUPAC name is 2-bromo-N-[(Z)-1-(3-fluorophenyl)-3-(4-hydroxypiperidin-1-yl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | 2-bromo-N-[(Z)-1-(3-fluorophenyl)-3-(4-hydroxypiperidin-1-yl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 126477398 |
| Molecular Formula | C21H20BrFN2O3 |
| Molecular Weight | 447.30 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | 2-bromo-N-[(Z)-1-(3-fluorophenyl)-3-(4-hydroxypiperidin-1-yl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(N/C(=C\c1cccc(F)c1)C(=O)N1CCC(O)CC1)c1ccccc1Br |
| InChI | InChI=1S/C21H20BrFN2O3/c22-18-7-2-1-6-17(18)20(27)24-19(13-14-4-3-5-15(23)12-14)21(28)25-10-8-16(26)9-11-25/h1-7,12-13,16,26H,8-11H2,(H,24,27)/b19-13- |
| InChIKey | LZNXEOVAUXMGES-UYRXBGFRSA-N |
| XLogP | 3.34 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|